Description
Dextrin Chemical Properties
| Melting point | 53.75-54 °C |
| density | 0.8 g/cm3 |
| storage temp. | Store at RT. |
| solubility | H2O: 0.1 g/mL hot, complete, yellow to very deep yellow |
| form | powder |
| color | yellow |
| Odor | odorless |
| Water Solubility | Soluble in hot water (0.1 g/ml). |
| Sensitive | Hygroscopic |
| Merck | 14,2953 |
| Dielectric constant | 2.2（Ambient） |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChIKey | FYGDTMLNYKFZSV-MRCIVHHJSA-N |
| SMILES | O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)C1OC1[C@H](O)[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]2CO)O[C@@H]1CO |&1:1,4,6,8,13,15,19,20,22,24,27,31,r| |
| LogP | -4.673 (est) |
| EPA Substance Registry System | Dextrin (9004-53-9) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | HH9450000 |
| F | 3 |
| TSCA | Yes |
| HS Code | 35051000 |
Reviews
There are no reviews yet.