Description
N,N-Diethyl-p-phenylenediamine sulfate Chemical Properties
| Melting point | 184-186 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear |
| form | Crystalline Powder or Crystals With Lumps |
| color | White to beige |
| PH | 2.0-2.2 (50g/l, H2O, 20℃) |
| Water Solubility | Soluble in water and alcohol. |
| Sensitive | Light Sensitive |
| BRN | 4219768 |
| Boiling point | 274-275°C (1013 hPa) |
| InChI | InChI=1S/C10H16N2.H2O4S/c1-3-12(4-2)10-7-5-9(11)6-8-10;1-5(2,3)4/h5-8H,3-4,11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | AYLDJQABCMPYEN-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=C(N)C=C1.S(O)(O)(=O)=O |
| CAS DataBase Reference | 6283-63-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 22-23/24/25-20/21/22 |
| Safety Statements | 28-45-36/37/39-36-13-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | SS9625000 |
| F | 8-9-23 |
| Autoignition Temperature | 540 °C |
| HazardClass | 6.1(b) |
| PackingGroup | II |
| HS Code | 29215190 |
| Toxicity | LD50 orally in Rabbit: 497 mg/kg |
Reviews
There are no reviews yet.