Description
3-Chloro-2-hydroxypropyltrimethyl ammonium chloride Chemical Properties
| Melting point | 191-193°C |
| density | 1.154 g/mL at 25 °C |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | n20/D 1.4541 |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly), Water (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow |
| PH | 4.8 to 6.4(50g/L, 25℃) |
| Water Solubility | 835.2g/L at 20℃ |
| BRN | 6576172 |
| InChI | InChI=1S/C6H15ClNO.ClH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CSPHGSFZFWKVDL-UHFFFAOYSA-M |
| SMILES | [N+](C)(CC(O)CCl)(C)C.[Cl-] |
| LogP | -1.5 at 25℃ |
| CAS DataBase Reference | 3327-22-8(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride (3327-22-8) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-52/53-40 |
| Safety Statements | 26-36-61-36/37 |
| RIDADR | 2811 |
| WGK Germany | 2 |
| RTECS | BP5275400 |
| HS Code | 2923.90.0100 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Toxicity | LDLo subcutaneous in mouse: 500mg/kg |
Reviews
There are no reviews yet.